C14H10ClN3OS — CID 63047841
N-(6-chloro-8-methylquinolin-5-yl)-1,3-thiazole-4-carboxamide (PubChem CID 63047841) has the molecular formula C14H10ClN3OS and a molecular weight of 303.77 g/mol. Its IUPAC name is N-(6-chloro-8-methylquinolin-5-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(6-chloro-8-methylquinolin-5-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 63047841 |
| Molecular Formula | C14H10ClN3OS |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | N-(6-chloro-8-methylquinolin-5-yl)-1,3-thiazole-4-carboxamide |
| SMILES | Cc1cc(Cl)c(NC(=O)c2cscn2)c2cccnc12 |
| InChI | InChI=1S/C14H10ClN3OS/c1-8-5-10(15)13(9-3-2-4-16-12(8)9)18-14(19)11-6-20-7-17-11/h2-7H,1H3,(H,18,19) |
| InChIKey | WNIFPEIPZDAFHE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |