C13H9ClF4N2O — CID 103737695
N-(6-chloro-8-methylquinolin-5-yl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 103737695) has the molecular formula C13H9ClF4N2O and a molecular weight of 320.67 g/mol. Its IUPAC name is N-(6-chloro-8-methylquinolin-5-yl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(6-chloro-8-methylquinolin-5-yl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103737695 |
| Molecular Formula | C13H9ClF4N2O |
| Molecular Weight | 320.67 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | N-(6-chloro-8-methylquinolin-5-yl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | Cc1cc(Cl)c(NC(=O)C(F)(F)C(F)F)c2cccnc12 |
| InChI | InChI=1S/C13H9ClF4N2O/c1-6-5-8(14)10(7-3-2-4-19-9(6)7)20-12(21)13(17,18)11(15)16/h2-5,11H,1H3,(H,20,21) |
| InChIKey | GSODHTCSFLAKEG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.67 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|