C12H7ClF4N2O — CID 103732428
N-(8-chloroquinolin-5-yl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 103732428) has the molecular formula C12H7ClF4N2O and a molecular weight of 306.65 g/mol. Its IUPAC name is N-(8-chloroquinolin-5-yl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(8-chloroquinolin-5-yl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103732428 |
| Molecular Formula | C12H7ClF4N2O |
| Molecular Weight | 306.65 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | N-(8-chloroquinolin-5-yl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | O=C(Nc1ccc(Cl)c2ncccc12)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H7ClF4N2O/c13-7-3-4-8(6-2-1-5-18-9(6)7)19-11(20)12(16,17)10(14)15/h1-5,10H,(H,19,20) |
| InChIKey | OUKJSFXNIQRSCD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.65 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|