C14H8N4O9 — CID 151925186
4-[(2,4,6-trinitrobenzoyl)amino]benzoic acid (PubChem CID 151925186) has the molecular formula C14H8N4O9 and a molecular weight of 376.24 g/mol. Its IUPAC name is 4-[(2,4,6-trinitrobenzoyl)amino]benzoic acid.
| Compound Name | 4-[(2,4,6-trinitrobenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 151925186 |
| Molecular Formula | C14H8N4O9 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 4-[(2,4,6-trinitrobenzoyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H8N4O9/c19-13(15-8-3-1-7(2-4-8)14(20)21)12-10(17(24)25)5-9(16(22)23)6-11(12)18(26)27/h1-6H,(H,15,19)(H,20,21) |
| InChIKey | SXPJFBJVVQFHMV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 195.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|