C21H19N5O10 — CID 139144886
bis(4-aminobenzoic acid);2-methyl-1,3,5-trinitrobenzene (PubChem CID 139144886) has the molecular formula C21H19N5O10 and a molecular weight of 501.41 g/mol. Its IUPAC name is bis(4-aminobenzoic acid);2-methyl-1,3,5-trinitrobenzene.
| Compound Name | bis(4-aminobenzoic acid);2-methyl-1,3,5-trinitrobenzene |
|---|---|
| PubChem CID | 139144886 |
| Molecular Formula | C21H19N5O10 |
| Molecular Weight | 501.41 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | bis(4-aminobenzoic acid);2-methyl-1,3,5-trinitrobenzene |
| SMILES | Cc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-].Nc1ccc(C(=O)O)cc1.Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C7H5N3O6.2C7H7NO2/c1-4-6(9(13)14)2-5(8(11)12)3-7(4)10(15)16;2*8-6-3-1-5(2-4-6)7(9)10/h2-3H,1H3;2*1-4H,8H2,(H,9,10) |
| InChIKey | AKWSVVIDAZLTFH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 256.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|