C14H11N5O11 — CID 87639053
2-methyl-4,6-dinitrophenol;2-methyl-1,3,5-trinitrobenzene (PubChem CID 87639053) has the molecular formula C14H11N5O11 and a molecular weight of 425.27 g/mol. Its IUPAC name is 2-methyl-4,6-dinitrophenol;2-methyl-1,3,5-trinitrobenzene.
| Compound Name | 2-methyl-4,6-dinitrophenol;2-methyl-1,3,5-trinitrobenzene |
|---|---|
| PubChem CID | 87639053 |
| Molecular Formula | C14H11N5O11 |
| Molecular Weight | 425.27 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 2-methyl-4,6-dinitrophenol;2-methyl-1,3,5-trinitrobenzene |
| SMILES | Cc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-].Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C7H5N3O6.C7H6N2O5/c1-4-6(9(13)14)2-5(8(11)12)3-7(4)10(15)16;1-4-2-5(8(11)12)3-6(7(4)10)9(13)14/h2-3H,1H3;2-3,10H,1H3 |
| InChIKey | RBRVIKDAKAGAAE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 235.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|