C19H18N6O9S — CID 139085389
4-amino-N-(4,6-dimethylpyrimidin-1-ium-2-yl)benzenesulfonamide;2-carboxy-4,6-dinitrophenolate (PubChem CID 139085389) has the molecular formula C19H18N6O9S and a molecular weight of 506.45 g/mol. Its IUPAC name is 4-amino-N-(4,6-dimethylpyrimidin-1-ium-2-yl)benzenesulfonamide;2-carboxy-4,6-dinitrophenolate.
| Compound Name | 4-amino-N-(4,6-dimethylpyrimidin-1-ium-2-yl)benzenesulfonamide;2-carboxy-4,6-dinitrophenolate |
|---|---|
| PubChem CID | 139085389 |
| Molecular Formula | C19H18N6O9S |
| Molecular Weight | 506.45 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | 4-amino-N-(4,6-dimethylpyrimidin-1-ium-2-yl)benzenesulfonamide;2-carboxy-4,6-dinitrophenolate |
| SMILES | Cc1cc(C)[nH+]c(NS(=O)(=O)c2ccc(N)cc2)n1.O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C12H14N4O2S.C7H4N2O7/c1-8-7-9(2)15-12(14-8)16-19(17,18)11-5-3-10(13)4-6-11;10-6-4(7(11)12)1-3(8(13)14)2-5(6)9(15)16/h3-7H,13H2,1-2H3,(H,14,15,16);1-2,10H,(H,11,12) |
| InChIKey | FYYKGYGNPPCPRO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 245.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.45 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|