C16H19N5O5S — CID 69385470
4-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide;(Z)-4-amino-4-oxobut-2-enoic acid (PubChem CID 69385470) has the molecular formula C16H19N5O5S and a molecular weight of 393.43 g/mol. Its IUPAC name is 4-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide;(Z)-4-amino-4-oxobut-2-enoic acid.
| Compound Name | 4-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide;(Z)-4-amino-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 69385470 |
| Molecular Formula | C16H19N5O5S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 4-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide;(Z)-4-amino-4-oxobut-2-enoic acid |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(N)cc2)n1.NC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C12H14N4O2S.C4H5NO3/c1-8-7-9(2)15-12(14-8)16-19(17,18)11-5-3-10(13)4-6-11;5-3(6)1-2-4(7)8/h3-7H,13H2,1-2H3,(H,14,15,16);1-2H,(H2,5,6)(H,7,8)/b;2-1- |
| InChIKey | SUSQFJXSNRQEIT-BTJKTKAUSA-N |
| XLogP | 0.59 |
| TPSA | 178.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|