C15H14N4O2S2 — CID 51063034
4-amino-N-(4-methyl-6-thiophen-3-ylpyrimidin-2-yl)benzenesulfonamide (PubChem CID 51063034) has the molecular formula C15H14N4O2S2 and a molecular weight of 346.44 g/mol. Its IUPAC name is 4-amino-N-(4-methyl-6-thiophen-3-ylpyrimidin-2-yl)benzenesulfonamide.
| Compound Name | 4-amino-N-(4-methyl-6-thiophen-3-ylpyrimidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 51063034 |
| Molecular Formula | C15H14N4O2S2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 4-amino-N-(4-methyl-6-thiophen-3-ylpyrimidin-2-yl)benzenesulfonamide |
| SMILES | Cc1cc(-c2ccsc2)nc(NS(=O)(=O)c2ccc(N)cc2)n1 |
| InChI | InChI=1S/C15H14N4O2S2/c1-10-8-14(11-6-7-22-9-11)18-15(17-10)19-23(20,21)13-4-2-12(16)3-5-13/h2-9H,16H2,1H3,(H,17,18,19) |
| InChIKey | XKJWNTUDCYSNQZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|