C16H16N8O3S2 — CID 136677867
4-[(2,6-diamino-4-oxo-1,3-thiazin-5-yl)diazenyl]-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide (PubChem CID 136677867) has the molecular formula C16H16N8O3S2 and a molecular weight of 432.49 g/mol. Its IUPAC name is 4-[(2,6-diamino-4-oxo-1,3-thiazin-5-yl)diazenyl]-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide.
| Compound Name | 4-[(2,6-diamino-4-oxo-1,3-thiazin-5-yl)diazenyl]-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 136677867 |
| Molecular Formula | C16H16N8O3S2 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 4-[(2,6-diamino-4-oxo-1,3-thiazin-5-yl)diazenyl]-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(/N=N/c3c(N)sc(N)nc3=O)cc2)n1 |
| InChI | InChI=1S/C16H16N8O3S2/c1-8-7-9(2)20-16(19-8)24-29(26,27)11-5-3-10(4-6-11)22-23-12-13(17)28-15(18)21-14(12)25/h3-7H,17H2,1-2H3,(H2,18,21,25)(H,19,20,24)/b23-22+ |
| InChIKey | GQMNPDLWLKEMHY-GHVJWSGMSA-N |
| XLogP | 2.29 |
| TPSA | 178.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|