C23H21N5O4S — CID 91253944
4-[(1-acetyl-5-methyl-2-oxoindol-3-ylidene)amino]-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide (PubChem CID 91253944) has the molecular formula C23H21N5O4S and a molecular weight of 463.52 g/mol. Its IUPAC name is 4-[(1-acetyl-5-methyl-2-oxoindol-3-ylidene)amino]-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide.
| Compound Name | 4-[(1-acetyl-5-methyl-2-oxoindol-3-ylidene)amino]-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 91253944 |
| Molecular Formula | C23H21N5O4S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 4-[(1-acetyl-5-methyl-2-oxoindol-3-ylidene)amino]-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
| SMILES | CC(=O)N1C(=O)/C(=N\c2ccc(S(=O)(=O)Nc3nc(C)cc(C)n3)cc2)c2cc(C)ccc21 |
| InChI | InChI=1S/C23H21N5O4S/c1-13-5-10-20-19(11-13)21(22(30)28(20)16(4)29)26-17-6-8-18(9-7-17)33(31,32)27-23-24-14(2)12-15(3)25-23/h5-12H,1-4H3,(H,24,25,27)/b26-21- |
| InChIKey | IFUXSSZDXHBRSI-QLYXXIJNSA-N |
| XLogP | 3.22 |
| TPSA | 121.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|