C18H18N4O2S2 — CID 4266689
N-(4,6-dimethylpyrimidin-2-yl)-4-[(5-methylthiophen-2-yl)methylideneamino]benzenesulfonamide (PubChem CID 4266689) has the molecular formula C18H18N4O2S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-(4,6-dimethylpyrimidin-2-yl)-4-[(5-methylthiophen-2-yl)methylideneamino]benzenesulfonamide.
| Compound Name | N-(4,6-dimethylpyrimidin-2-yl)-4-[(5-methylthiophen-2-yl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 4266689 |
| Molecular Formula | C18H18N4O2S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | N-(4,6-dimethylpyrimidin-2-yl)-4-[(5-methylthiophen-2-yl)methylideneamino]benzenesulfonamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(/N=C/c3ccc(C)s3)cc2)n1 |
| InChI | InChI=1S/C18H18N4O2S2/c1-12-10-13(2)21-18(20-12)22-26(23,24)17-8-5-15(6-9-17)19-11-16-7-4-14(3)25-16/h4-11H,1-3H3,(H,20,21,22)/b19-11+ |
| InChIKey | PYNWOUZVOUSSAZ-YBFXNURJSA-N |
| XLogP | 4.01 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|