C18H20N4O4S — CID 59680651
4-(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl)-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide (PubChem CID 59680651) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is 4-(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl)-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide.
| Compound Name | 4-(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl)-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 59680651 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 4-(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl)-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(N3C(=O)C(C)C(C)C3=O)cc2)n1 |
| InChI | InChI=1S/C18H20N4O4S/c1-10-9-11(2)20-18(19-10)21-27(25,26)15-7-5-14(6-8-15)22-16(23)12(3)13(4)17(22)24/h5-9,12-13H,1-4H3,(H,19,20,21) |
| InChIKey | YZWNLQUJDGNLSF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|