C19H15N3O6S — CID 54444291
2-[[4-(4-aminophenyl)-3-nitrophenyl]sulfonylamino]benzoic acid (PubChem CID 54444291) has the molecular formula C19H15N3O6S and a molecular weight of 413.41 g/mol. Its IUPAC name is 2-[[4-(4-aminophenyl)-3-nitrophenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[4-(4-aminophenyl)-3-nitrophenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 54444291 |
| Molecular Formula | C19H15N3O6S |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 2-[[4-(4-aminophenyl)-3-nitrophenyl]sulfonylamino]benzoic acid |
| SMILES | Nc1ccc(-c2ccc(S(=O)(=O)Nc3ccccc3C(=O)O)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H15N3O6S/c20-13-7-5-12(6-8-13)15-10-9-14(11-18(15)22(25)26)29(27,28)21-17-4-2-1-3-16(17)19(23)24/h1-11,21H,20H2,(H,23,24) |
| InChIKey | WQJXCQFAHBCGII-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 152.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|