C20H16N4O7S — CID 6140567
2-[[4-[(2Z)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid (PubChem CID 6140567) has the molecular formula C20H16N4O7S and a molecular weight of 456.44 g/mol. Its IUPAC name is 2-[[4-[(2Z)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[4-[(2Z)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 6140567 |
| Molecular Formula | C20H16N4O7S |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 2-[[4-[(2Z)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NS(=O)(=O)c1ccc(N/N=C\c2cccc(O)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H16N4O7S/c25-14-5-3-4-13(10-14)12-21-22-18-9-8-15(11-19(18)24(28)29)32(30,31)23-17-7-2-1-6-16(17)20(26)27/h1-12,22-23,25H,(H,26,27)/b21-12- |
| InChIKey | BMRYCJWCRFZAOH-MTJSOVHGSA-N |
| XLogP | 3.25 |
| TPSA | 171.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|