C25H25F2IN4O5S — CID 87967029
N-(cyclopropylmethoxy)-3,4-difluoro-5-[[3-(2-hydroxyethyl)-2-pyridinyl]methylsulfamoyl]-2-(4-iodoanilino)benzamide (PubChem CID 87967029) has the molecular formula C25H25F2IN4O5S and a molecular weight of 658.47 g/mol. Its IUPAC name is N-(cyclopropylmethoxy)-3,4-difluoro-5-[[3-(2-hydroxyethyl)-2-pyridinyl]methylsulfamoyl]-2-(4-iodoanilino)benzamide.
| Compound Name | N-(cyclopropylmethoxy)-3,4-difluoro-5-[[3-(2-hydroxyethyl)-2-pyridinyl]methylsulfamoyl]-2-(4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 87967029 |
| Molecular Formula | C25H25F2IN4O5S |
| Molecular Weight | 658.47 g/mol |
| Exact Mass | 658.06 |
| IUPAC Name | N-(cyclopropylmethoxy)-3,4-difluoro-5-[[3-(2-hydroxyethyl)-2-pyridinyl]methylsulfamoyl]-2-(4-iodoanilino)benzamide |
| SMILES | O=C(NOCC1CC1)c1cc(S(=O)(=O)NCc2ncccc2CCO)c(F)c(F)c1Nc1ccc(I)cc1 |
| InChI | InChI=1S/C25H25F2IN4O5S/c26-22-21(38(35,36)30-13-20-16(9-11-33)2-1-10-29-20)12-19(25(34)32-37-14-15-3-4-15)24(23(22)27)31-18-7-5-17(28)6-8-18/h1-2,5-8,10,12,15,30-31,33H,3-4,9,11,13-14H2,(H,32,34) |
| InChIKey | QNGVYUUITXWGTL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|