C29H26F2IN5O4S — CID 87966165
5-[bis(pyridin-3-ylmethyl)sulfamoyl]-N-(cyclopropylmethoxy)-3,4-difluoro-2-(4-iodoanilino)benzamide (PubChem CID 87966165) has the molecular formula C29H26F2IN5O4S and a molecular weight of 705.53 g/mol. Its IUPAC name is 5-[bis(pyridin-3-ylmethyl)sulfamoyl]-N-(cyclopropylmethoxy)-3,4-difluoro-2-(4-iodoanilino)benzamide.
| Compound Name | 5-[bis(pyridin-3-ylmethyl)sulfamoyl]-N-(cyclopropylmethoxy)-3,4-difluoro-2-(4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 87966165 |
| Molecular Formula | C29H26F2IN5O4S |
| Molecular Weight | 705.53 g/mol |
| Exact Mass | 705.07 |
| IUPAC Name | 5-[bis(pyridin-3-ylmethyl)sulfamoyl]-N-(cyclopropylmethoxy)-3,4-difluoro-2-(4-iodoanilino)benzamide |
| SMILES | O=C(NOCC1CC1)c1cc(S(=O)(=O)N(Cc2cccnc2)Cc2cccnc2)c(F)c(F)c1Nc1ccc(I)cc1 |
| InChI | InChI=1S/C29H26F2IN5O4S/c30-26-25(42(39,40)37(16-20-3-1-11-33-14-20)17-21-4-2-12-34-15-21)13-24(29(38)36-41-18-19-5-6-19)28(27(26)31)35-23-9-7-22(32)8-10-23/h1-4,7-15,19,35H,5-6,16-18H2,(H,36,38) |
| InChIKey | NTNCPJGFRCARIU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.53 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|