C17H13Cl2F2IN2O2 — CID 22271643
5-chloro-2-(2-chloro-4-iodoanilino)-N-(cyclopropylmethoxy)-3,4-difluorobenzamide (PubChem CID 22271643) has the molecular formula C17H13Cl2F2IN2O2 and a molecular weight of 513.11 g/mol. Its IUPAC name is 5-chloro-2-(2-chloro-4-iodoanilino)-N-(cyclopropylmethoxy)-3,4-difluorobenzamide.
| Compound Name | 5-chloro-2-(2-chloro-4-iodoanilino)-N-(cyclopropylmethoxy)-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 22271643 |
| Molecular Formula | C17H13Cl2F2IN2O2 |
| Molecular Weight | 513.11 g/mol |
| Exact Mass | 511.94 |
| IUPAC Name | 5-chloro-2-(2-chloro-4-iodoanilino)-N-(cyclopropylmethoxy)-3,4-difluorobenzamide |
| SMILES | O=C(NOCC1CC1)c1cc(Cl)c(F)c(F)c1Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C17H13Cl2F2IN2O2/c18-11-5-9(22)3-4-13(11)23-16-10(6-12(19)14(20)15(16)21)17(25)24-26-7-8-1-2-8/h3-6,8,23H,1-2,7H2,(H,24,25) |
| InChIKey | YGRHTDDIYZYUDW-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.11 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|