C18H15ClF3IN2O3 — CID 22286415
2-(2-chloro-4-iodoanilino)-3,4,5-trifluoro-N-[[2-(hydroxymethyl)cyclopropyl]methoxy]benzamide (PubChem CID 22286415) has the molecular formula C18H15ClF3IN2O3 and a molecular weight of 526.68 g/mol. Its IUPAC name is 2-(2-chloro-4-iodoanilino)-3,4,5-trifluoro-N-[[2-(hydroxymethyl)cyclopropyl]methoxy]benzamide.
| Compound Name | 2-(2-chloro-4-iodoanilino)-3,4,5-trifluoro-N-[[2-(hydroxymethyl)cyclopropyl]methoxy]benzamide |
|---|---|
| PubChem CID | 22286415 |
| Molecular Formula | C18H15ClF3IN2O3 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 525.98 |
| IUPAC Name | 2-(2-chloro-4-iodoanilino)-3,4,5-trifluoro-N-[[2-(hydroxymethyl)cyclopropyl]methoxy]benzamide |
| SMILES | O=C(NOCC1CC1CO)c1cc(F)c(F)c(F)c1Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C18H15ClF3IN2O3/c19-12-4-10(23)1-2-14(12)24-17-11(5-13(20)15(21)16(17)22)18(27)25-28-7-9-3-8(9)6-26/h1-2,4-5,8-9,24,26H,3,6-7H2,(H,25,27) |
| InChIKey | AINLSSSMBLVBJO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|