C18H18Cl2FIN2O3 — CID 22286231
5-chloro-2-(2-chloro-4-iodoanilino)-4-fluoro-N-(2-hydroxy-3-methylbutoxy)benzamide (PubChem CID 22286231) has the molecular formula C18H18Cl2FIN2O3 and a molecular weight of 527.16 g/mol. Its IUPAC name is 5-chloro-2-(2-chloro-4-iodoanilino)-4-fluoro-N-(2-hydroxy-3-methylbutoxy)benzamide.
| Compound Name | 5-chloro-2-(2-chloro-4-iodoanilino)-4-fluoro-N-(2-hydroxy-3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 22286231 |
| Molecular Formula | C18H18Cl2FIN2O3 |
| Molecular Weight | 527.16 g/mol |
| Exact Mass | 525.97 |
| IUPAC Name | 5-chloro-2-(2-chloro-4-iodoanilino)-4-fluoro-N-(2-hydroxy-3-methylbutoxy)benzamide |
| SMILES | CC(C)C(O)CONC(=O)c1cc(Cl)c(F)cc1Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C18H18Cl2FIN2O3/c1-9(2)17(25)8-27-24-18(26)11-6-12(19)14(21)7-16(11)23-15-4-3-10(22)5-13(15)20/h3-7,9,17,23,25H,8H2,1-2H3,(H,24,26) |
| InChIKey | QKFGQKKVPARDFV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.16 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|