C19H21ClFIN2O3 — CID 22286040
5-chloro-4-fluoro-N-(3-hydroxy-3-methylbutoxy)-2-(4-iodo-2-methylanilino)benzamide (PubChem CID 22286040) has the molecular formula C19H21ClFIN2O3 and a molecular weight of 506.74 g/mol. Its IUPAC name is 5-chloro-4-fluoro-N-(3-hydroxy-3-methylbutoxy)-2-(4-iodo-2-methylanilino)benzamide.
| Compound Name | 5-chloro-4-fluoro-N-(3-hydroxy-3-methylbutoxy)-2-(4-iodo-2-methylanilino)benzamide |
|---|---|
| PubChem CID | 22286040 |
| Molecular Formula | C19H21ClFIN2O3 |
| Molecular Weight | 506.74 g/mol |
| Exact Mass | 506.03 |
| IUPAC Name | 5-chloro-4-fluoro-N-(3-hydroxy-3-methylbutoxy)-2-(4-iodo-2-methylanilino)benzamide |
| SMILES | Cc1cc(I)ccc1Nc1cc(F)c(Cl)cc1C(=O)NOCCC(C)(C)O |
| InChI | InChI=1S/C19H21ClFIN2O3/c1-11-8-12(22)4-5-16(11)23-17-10-15(21)14(20)9-13(17)18(25)24-27-7-6-19(2,3)26/h4-5,8-10,23,26H,6-7H2,1-3H3,(H,24,25) |
| InChIKey | OABXVKLFHAEPMF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.74 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|