C15H12ClF2IN2O4S — CID 12990663
2-(2-chloro-4-iodoanilino)-5-(dimethylsulfamoyl)-3,4-difluorobenzoic acid (PubChem CID 12990663) has the molecular formula C15H12ClF2IN2O4S and a molecular weight of 516.69 g/mol. Its IUPAC name is 2-(2-chloro-4-iodoanilino)-5-(dimethylsulfamoyl)-3,4-difluorobenzoic acid.
| Compound Name | 2-(2-chloro-4-iodoanilino)-5-(dimethylsulfamoyl)-3,4-difluorobenzoic acid |
|---|---|
| PubChem CID | 12990663 |
| Molecular Formula | C15H12ClF2IN2O4S |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 515.92 |
| IUPAC Name | 2-(2-chloro-4-iodoanilino)-5-(dimethylsulfamoyl)-3,4-difluorobenzoic acid |
| SMILES | CN(C)S(=O)(=O)c1cc(C(=O)O)c(Nc2ccc(I)cc2Cl)c(F)c1F |
| InChI | InChI=1S/C15H12ClF2IN2O4S/c1-21(2)26(24,25)11-6-8(15(22)23)14(13(18)12(11)17)20-10-4-3-7(19)5-9(10)16/h3-6,20H,1-2H3,(H,22,23) |
| InChIKey | MKBLLMKZYFKAGL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|