C19H5BrClF7INO2 — CID 23398487
(2,3,4,5,6-pentafluorophenyl) 5-bromo-2-(2-chloro-4-iodoanilino)-3,4-difluorobenzoate (PubChem CID 23398487) has the molecular formula C19H5BrClF7INO2 and a molecular weight of 654.50 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 5-bromo-2-(2-chloro-4-iodoanilino)-3,4-difluorobenzoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 5-bromo-2-(2-chloro-4-iodoanilino)-3,4-difluorobenzoate |
|---|---|
| PubChem CID | 23398487 |
| Molecular Formula | C19H5BrClF7INO2 |
| Molecular Weight | 654.50 g/mol |
| Exact Mass | 652.81 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 5-bromo-2-(2-chloro-4-iodoanilino)-3,4-difluorobenzoate |
| SMILES | O=C(Oc1c(F)c(F)c(F)c(F)c1F)c1cc(Br)c(F)c(F)c1Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C19H5BrClF7INO2/c20-7-4-6(19(31)32-18-15(27)12(24)11(23)13(25)16(18)28)17(14(26)10(7)22)30-9-2-1-5(29)3-8(9)21/h1-4,30H |
| InChIKey | WVLDYWGSVXOEFS-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.50 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|