C23H17BrF7NO2 — CID 142108925
ethane;(2,3,4,5,6-pentafluorophenyl) 5-bromo-2-(2,4-dimethylanilino)-3,4-difluorobenzoate (PubChem CID 142108925) has the molecular formula C23H17BrF7NO2 and a molecular weight of 552.28 g/mol. Its IUPAC name is ethane;(2,3,4,5,6-pentafluorophenyl) 5-bromo-2-(2,4-dimethylanilino)-3,4-difluorobenzoate.
| Compound Name | ethane;(2,3,4,5,6-pentafluorophenyl) 5-bromo-2-(2,4-dimethylanilino)-3,4-difluorobenzoate |
|---|---|
| PubChem CID | 142108925 |
| Molecular Formula | C23H17BrF7NO2 |
| Molecular Weight | 552.28 g/mol |
| Exact Mass | 551.03 |
| IUPAC Name | ethane;(2,3,4,5,6-pentafluorophenyl) 5-bromo-2-(2,4-dimethylanilino)-3,4-difluorobenzoate |
| SMILES | CC.Cc1ccc(Nc2c(C(=O)Oc3c(F)c(F)c(F)c(F)c3F)cc(Br)c(F)c2F)c(C)c1 |
| InChI | InChI=1S/C21H11BrF7NO2.C2H6/c1-7-3-4-11(8(2)5-7)30-19-9(6-10(22)12(23)16(19)27)21(31)32-20-17(28)14(25)13(24)15(26)18(20)29;1-2/h3-6,30H,1-2H3;1-2H3 |
| InChIKey | UTYHNTLLNBNLQQ-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.28 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|