C16H17F2N — CID 18337061
N-(2,4-dimethylphenyl)-2,3-difluoro-4,6-dimethylaniline (PubChem CID 18337061) has the molecular formula C16H17F2N and a molecular weight of 261.31 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2,3-difluoro-4,6-dimethylaniline.
| Compound Name | N-(2,4-dimethylphenyl)-2,3-difluoro-4,6-dimethylaniline |
|---|---|
| PubChem CID | 18337061 |
| Molecular Formula | C16H17F2N |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2,3-difluoro-4,6-dimethylaniline |
| SMILES | Cc1ccc(Nc2c(C)cc(C)c(F)c2F)c(C)c1 |
| InChI | InChI=1S/C16H17F2N/c1-9-5-6-13(10(2)7-9)19-16-12(4)8-11(3)14(17)15(16)18/h5-8,19H,1-4H3 |
| InChIKey | HPZPFWPSODDDTG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |