C20H24F2N2O2S — CID 143758056
N-[2-(2,4-dimethylanilino)-3,4-difluorophenyl]cyclohexanesulfonamide (PubChem CID 143758056) has the molecular formula C20H24F2N2O2S and a molecular weight of 394.49 g/mol. Its IUPAC name is N-[2-(2,4-dimethylanilino)-3,4-difluorophenyl]cyclohexanesulfonamide.
| Compound Name | N-[2-(2,4-dimethylanilino)-3,4-difluorophenyl]cyclohexanesulfonamide |
|---|---|
| PubChem CID | 143758056 |
| Molecular Formula | C20H24F2N2O2S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-[2-(2,4-dimethylanilino)-3,4-difluorophenyl]cyclohexanesulfonamide |
| SMILES | Cc1ccc(Nc2c(NS(=O)(=O)C3CCCCC3)ccc(F)c2F)c(C)c1 |
| InChI | InChI=1S/C20H24F2N2O2S/c1-13-8-10-17(14(2)12-13)23-20-18(11-9-16(21)19(20)22)24-27(25,26)15-6-4-3-5-7-15/h8-12,15,23-24H,3-7H2,1-2H3 |
| InChIKey | UPNCHZRNDNTUKS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |