C12H18N2O2S — CID 65419614
N-(2,4-dimethylphenyl)pyrrolidine-3-sulfonamide (PubChem CID 65419614) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)pyrrolidine-3-sulfonamide.
| Compound Name | N-(2,4-dimethylphenyl)pyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 65419614 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | N-(2,4-dimethylphenyl)pyrrolidine-3-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)C2CCNC2)c(C)c1 |
| InChI | InChI=1S/C12H18N2O2S/c1-9-3-4-12(10(2)7-9)14-17(15,16)11-5-6-13-8-11/h3-4,7,11,13-14H,5-6,8H2,1-2H3 |
| InChIKey | IHZZTSGADNRDCA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |