C13H20N2O2S — CID 24699757
N-(2,5-dimethylphenyl)piperidine-3-sulfonamide (PubChem CID 24699757) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)piperidine-3-sulfonamide.
| Compound Name | N-(2,5-dimethylphenyl)piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 24699757 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-(2,5-dimethylphenyl)piperidine-3-sulfonamide |
| SMILES | Cc1ccc(C)c(NS(=O)(=O)C2CCCNC2)c1 |
| InChI | InChI=1S/C13H20N2O2S/c1-10-5-6-11(2)13(8-10)15-18(16,17)12-4-3-7-14-9-12/h5-6,8,12,14-15H,3-4,7,9H2,1-2H3 |
| InChIKey | NBDSFUHXJRNASB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |