C11H13BrF2N2O2S — CID 155193788
N-(3-bromo-2,4-difluorophenyl)piperidine-3-sulfonamide (PubChem CID 155193788) has the molecular formula C11H13BrF2N2O2S and a molecular weight of 355.20 g/mol. Its IUPAC name is N-(3-bromo-2,4-difluorophenyl)piperidine-3-sulfonamide.
| Compound Name | N-(3-bromo-2,4-difluorophenyl)piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 155193788 |
| Molecular Formula | C11H13BrF2N2O2S |
| Molecular Weight | 355.20 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | N-(3-bromo-2,4-difluorophenyl)piperidine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)c(Br)c1F)C1CCCNC1 |
| InChI | InChI=1S/C11H13BrF2N2O2S/c12-10-8(13)3-4-9(11(10)14)16-19(17,18)7-2-1-5-15-6-7/h3-4,7,15-16H,1-2,5-6H2 |
| InChIKey | KQHGSHAIXCMRKL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|