C12H16Br2N2O3S — CID 103415161
N-(2,4-dibromo-5-methoxyphenyl)piperidine-3-sulfonamide (PubChem CID 103415161) has the molecular formula C12H16Br2N2O3S and a molecular weight of 428.15 g/mol. Its IUPAC name is N-(2,4-dibromo-5-methoxyphenyl)piperidine-3-sulfonamide.
| Compound Name | N-(2,4-dibromo-5-methoxyphenyl)piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 103415161 |
| Molecular Formula | C12H16Br2N2O3S |
| Molecular Weight | 428.15 g/mol |
| Exact Mass | 425.92 |
| IUPAC Name | N-(2,4-dibromo-5-methoxyphenyl)piperidine-3-sulfonamide |
| SMILES | COc1cc(NS(=O)(=O)C2CCCNC2)c(Br)cc1Br |
| InChI | InChI=1S/C12H16Br2N2O3S/c1-19-12-6-11(9(13)5-10(12)14)16-20(17,18)8-3-2-4-15-7-8/h5-6,8,15-16H,2-4,7H2,1H3 |
| InChIKey | JQPDZCJYQKUGNC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.15 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |