C15H22N2O2S — CID 24710203
N-(5,6,7,8-tetrahydronaphthalen-1-yl)piperidine-3-sulfonamide (PubChem CID 24710203) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is N-(5,6,7,8-tetrahydronaphthalen-1-yl)piperidine-3-sulfonamide.
| Compound Name | N-(5,6,7,8-tetrahydronaphthalen-1-yl)piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 24710203 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-(5,6,7,8-tetrahydronaphthalen-1-yl)piperidine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc2c1CCCC2)C1CCCNC1 |
| InChI | InChI=1S/C15H22N2O2S/c18-20(19,13-7-4-10-16-11-13)17-15-9-3-6-12-5-1-2-8-14(12)15/h3,6,9,13,16-17H,1-2,4-5,7-8,10-11H2 |
| InChIKey | YJVRLMBWSJGQHP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |