About N-[3,4-difluoro-2-[2-fluoro-4-(1H-pyrazol-5-yl)anilino]phenyl]cyclopropanesulfonamide
N-[3,4-difluoro-2-[2-fluoro-4-(1H-pyrazol-5-yl)anilino]phenyl]cyclopropanesulfonamide (PubChem CID 59386340) has the molecular formula C18H15F3N4O2S
and a molecular weight of 408.41 g/mol. Its IUPAC name is N-[3,4-difluoro-2-[2-fluoro-4-(1H-pyrazol-5-yl)anilino]phenyl]cyclopropanesulfonamide.
Molecular Properties
| Compound Name | N-[3,4-difluoro-2-[2-fluoro-4-(1H-pyrazol-5-yl)anilino]phenyl]cyclopropanesulfonamide |
| PubChem CID | 59386340 |
| Molecular Formula | C18H15F3N4O2S |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | N-[3,4-difluoro-2-[2-fluoro-4-(1H-pyrazol-5-yl)anilino]phenyl]cyclopropanesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)c(F)c1Nc1ccc(-c2ccn[nH]2)cc1F)C1CC1 |
| InChI | InChI=1S/C18H15F3N4O2S/c19-12-4-6-16(25-28(26,27)11-2-3-11)18(17(12)21)23-15-5-1-10(9-13(15)20)14-7-8-22-24-14/h1,4-9,11,23,25H,2-3H2,(H,22,24) |
| InChIKey | CCHPLFBIPNLLCX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3,4-difluoro-2-[2-fluoro-4-(1H-pyrazol-5-yl)anilino]phenyl]cyclopropanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,4-difluoro-2-[2-fluoro-4-(1H-pyrazol-5-yl)anilino]phenyl]cyclopropanesulfonamide?
The IUPAC name of N-[3,4-difluoro-2-[2-fluoro-4-(1H-pyrazol-5-yl)anilino]phenyl]cyclopropanesulfonamide (CID 59386340) is N-[3,4-difluoro-2-[2-fluoro-4-(1H-pyrazol-5-yl)anilino]phenyl]cyclopropanesulfonamide.
What is the SMILES notation for N-[3,4-difluoro-2-[2-fluoro-4-(1H-pyrazol-5-yl)anilino]phenyl]cyclopropanesulfonamide?
The canonical SMILES for N-[3,4-difluoro-2-[2-fluoro-4-(1H-pyrazol-5-yl)anilino]phenyl]cyclopropanesulfonamide is O=S(=O)(Nc1ccc(F)c(F)c1Nc1ccc(-c2ccn[nH]2)cc1F)C1CC1.
What is the InChIKey of N-[3,4-difluoro-2-[2-fluoro-4-(1H-pyrazol-5-yl)anilino]phenyl]cyclopropanesulfonamide?
The InChIKey is CCHPLFBIPNLLCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F3N4O2S/c19-12-4-6-16(25-28(26,27)11-2-3-11)18(17(12)21)23-15-5-1-10(9-13(15)20)14-7-8-22-24-14/h1,4-9,11,23,25H,2-3H2,(H,22,24).
What are the key properties of N-[3,4-difluoro-2-[2-fluoro-4-(1H-pyrazol-5-yl)anilino]phenyl]cyclopropanesulfonamide?
N-[3,4-difluoro-2-[2-fluoro-4-(1H-pyrazol-5-yl)anilino]phenyl]cyclopropanesulfonamide has a molecular weight of 408.41 g/mol, XLogP of 4.14, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,4-difluoro-2-[2-fluoro-4-(1H-pyrazol-5-yl)anilino]phenyl]cyclopropanesulfonamide is sourced from PubChem (CID 59386340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).