C18H19F2IN2O2S — CID 143399893
N-[3,4-difluoro-2-(4-iodo-2-methylanilino)phenyl]cyclopentanesulfonamide (PubChem CID 143399893) has the molecular formula C18H19F2IN2O2S and a molecular weight of 492.33 g/mol. Its IUPAC name is N-[3,4-difluoro-2-(4-iodo-2-methylanilino)phenyl]cyclopentanesulfonamide.
| Compound Name | N-[3,4-difluoro-2-(4-iodo-2-methylanilino)phenyl]cyclopentanesulfonamide |
|---|---|
| PubChem CID | 143399893 |
| Molecular Formula | C18H19F2IN2O2S |
| Molecular Weight | 492.33 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | N-[3,4-difluoro-2-(4-iodo-2-methylanilino)phenyl]cyclopentanesulfonamide |
| SMILES | Cc1cc(I)ccc1Nc1c(NS(=O)(=O)C2CCCC2)ccc(F)c1F |
| InChI | InChI=1S/C18H19F2IN2O2S/c1-11-10-12(21)6-8-15(11)22-18-16(9-7-14(19)17(18)20)23-26(24,25)13-4-2-3-5-13/h6-10,13,22-23H,2-5H2,1H3 |
| InChIKey | PMPDGFFBQDMPSQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.33 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|