3,4,6-trifluoro-2-(4-iodo-2-methylanilino)benzoic acid

C14H9F3INO2 — CID 22226015

IUPAC3,4,6-trifluoro-2-(4-iodo-2-methylanilino)benzoic acid
SMILESCc1cc(I)ccc1Nc1c(F)c(F)cc(F)c1C(=O)O
InChIInChI=1S/C14H9F3INO2/c1-6-4-7(18)2-3-10(6)19-13-11(14(20)21)8(15)5-9(16)12(13)17/h2-5,19H,1H3,(H,20,21)
InChIKeyFVGSZWKXTGCRHP-UHFFFAOYSA-N
MW407.13 g/mol
LogP4.46
Rot. Bonds3

About 3,4,6-trifluoro-2-(4-iodo-2-methylanilino)benzoic acid

3,4,6-trifluoro-2-(4-iodo-2-methylanilino)benzoic acid (PubChem CID 22226015) has the molecular formula C14H9F3INO2 and a molecular weight of 407.13 g/mol. Its IUPAC name is 3,4,6-trifluoro-2-(4-iodo-2-methylanilino)benzoic acid.

Molecular Properties

Compound Name3,4,6-trifluoro-2-(4-iodo-2-methylanilino)benzoic acid
PubChem CID22226015
Molecular FormulaC14H9F3INO2
Molecular Weight407.13 g/mol
Exact Mass406.96
IUPAC Name3,4,6-trifluoro-2-(4-iodo-2-methylanilino)benzoic acid
SMILESCc1cc(I)ccc1Nc1c(F)c(F)cc(F)c1C(=O)O
InChIInChI=1S/C14H9F3INO2/c1-6-4-7(18)2-3-10(6)19-13-11(14(20)21)8(15)5-9(16)12(13)17/h2-5,19H,1H3,(H,20,21)
InChIKeyFVGSZWKXTGCRHP-UHFFFAOYSA-N
XLogP4.46
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500407.13
LogP ≤ 54.46
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 3,4,6-trifluoro-2-(4-iodo-2-methylanilino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4,6-trifluoro-2-(4-iodo-2-methylanilino)benzoic acid?
The IUPAC name of 3,4,6-trifluoro-2-(4-iodo-2-methylanilino)benzoic acid (CID 22226015) is 3,4,6-trifluoro-2-(4-iodo-2-methylanilino)benzoic acid.
What is the SMILES notation for 3,4,6-trifluoro-2-(4-iodo-2-methylanilino)benzoic acid?
The canonical SMILES for 3,4,6-trifluoro-2-(4-iodo-2-methylanilino)benzoic acid is Cc1cc(I)ccc1Nc1c(F)c(F)cc(F)c1C(=O)O.
What is the InChIKey of 3,4,6-trifluoro-2-(4-iodo-2-methylanilino)benzoic acid?
The InChIKey is FVGSZWKXTGCRHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F3INO2/c1-6-4-7(18)2-3-10(6)19-13-11(14(20)21)8(15)5-9(16)12(13)17/h2-5,19H,1H3,(H,20,21).
What are the key properties of 3,4,6-trifluoro-2-(4-iodo-2-methylanilino)benzoic acid?
3,4,6-trifluoro-2-(4-iodo-2-methylanilino)benzoic acid has a molecular weight of 407.13 g/mol, XLogP of 4.46, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,6-trifluoro-2-(4-iodo-2-methylanilino)benzoic acid is sourced from PubChem (CID 22226015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).