C21H23F2IN4O3 — CID 22244042
5-[4-(2-aminoethyl)piperazine-1-carbonyl]-3,4-difluoro-2-(4-iodo-2-methylanilino)benzoic acid (PubChem CID 22244042) has the molecular formula C21H23F2IN4O3 and a molecular weight of 544.34 g/mol. Its IUPAC name is 5-[4-(2-aminoethyl)piperazine-1-carbonyl]-3,4-difluoro-2-(4-iodo-2-methylanilino)benzoic acid.
| Compound Name | 5-[4-(2-aminoethyl)piperazine-1-carbonyl]-3,4-difluoro-2-(4-iodo-2-methylanilino)benzoic acid |
|---|---|
| PubChem CID | 22244042 |
| Molecular Formula | C21H23F2IN4O3 |
| Molecular Weight | 544.34 g/mol |
| Exact Mass | 544.08 |
| IUPAC Name | 5-[4-(2-aminoethyl)piperazine-1-carbonyl]-3,4-difluoro-2-(4-iodo-2-methylanilino)benzoic acid |
| SMILES | Cc1cc(I)ccc1Nc1c(C(=O)O)cc(C(=O)N2CCN(CCN)CC2)c(F)c1F |
| InChI | InChI=1S/C21H23F2IN4O3/c1-12-10-13(24)2-3-16(12)26-19-15(21(30)31)11-14(17(22)18(19)23)20(29)28-8-6-27(5-4-25)7-9-28/h2-3,10-11,26H,4-9,25H2,1H3,(H,30,31) |
| InChIKey | PCSQPJNQVSSDOI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|