C26H21F2IN4O3S — CID 22243988
5-[4-(1,3-benzothiazol-2-yl)piperazine-1-carbonyl]-3,4-difluoro-2-(4-iodo-2-methylanilino)benzoic acid (PubChem CID 22243988) has the molecular formula C26H21F2IN4O3S and a molecular weight of 634.45 g/mol. Its IUPAC name is 5-[4-(1,3-benzothiazol-2-yl)piperazine-1-carbonyl]-3,4-difluoro-2-(4-iodo-2-methylanilino)benzoic acid.
| Compound Name | 5-[4-(1,3-benzothiazol-2-yl)piperazine-1-carbonyl]-3,4-difluoro-2-(4-iodo-2-methylanilino)benzoic acid |
|---|---|
| PubChem CID | 22243988 |
| Molecular Formula | C26H21F2IN4O3S |
| Molecular Weight | 634.45 g/mol |
| Exact Mass | 634.03 |
| IUPAC Name | 5-[4-(1,3-benzothiazol-2-yl)piperazine-1-carbonyl]-3,4-difluoro-2-(4-iodo-2-methylanilino)benzoic acid |
| SMILES | Cc1cc(I)ccc1Nc1c(C(=O)O)cc(C(=O)N2CCN(c3nc4ccccc4s3)CC2)c(F)c1F |
| InChI | InChI=1S/C26H21F2IN4O3S/c1-14-12-15(29)6-7-18(14)30-23-17(25(35)36)13-16(21(27)22(23)28)24(34)32-8-10-33(11-9-32)26-31-19-4-2-3-5-20(19)37-26/h2-7,12-13,30H,8-11H2,1H3,(H,35,36) |
| InChIKey | RXIGJNPMYKYNGL-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.45 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|