C24H22F2IN5O3 — CID 22243986
3,4-difluoro-2-(4-iodo-2-methylanilino)-5-[4-(6-methylpyridazin-3-yl)piperazine-1-carbonyl]benzoic acid (PubChem CID 22243986) has the molecular formula C24H22F2IN5O3 and a molecular weight of 593.37 g/mol. Its IUPAC name is 3,4-difluoro-2-(4-iodo-2-methylanilino)-5-[4-(6-methylpyridazin-3-yl)piperazine-1-carbonyl]benzoic acid.
| Compound Name | 3,4-difluoro-2-(4-iodo-2-methylanilino)-5-[4-(6-methylpyridazin-3-yl)piperazine-1-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 22243986 |
| Molecular Formula | C24H22F2IN5O3 |
| Molecular Weight | 593.37 g/mol |
| Exact Mass | 593.07 |
| IUPAC Name | 3,4-difluoro-2-(4-iodo-2-methylanilino)-5-[4-(6-methylpyridazin-3-yl)piperazine-1-carbonyl]benzoic acid |
| SMILES | Cc1ccc(N2CCN(C(=O)c3cc(C(=O)O)c(Nc4ccc(I)cc4C)c(F)c3F)CC2)nn1 |
| InChI | InChI=1S/C24H22F2IN5O3/c1-13-11-15(27)4-5-18(13)28-22-17(24(34)35)12-16(20(25)21(22)26)23(33)32-9-7-31(8-10-32)19-6-3-14(2)29-30-19/h3-6,11-12,28H,7-10H2,1-2H3,(H,34,35) |
| InChIKey | UTJKIGXGZSZUAD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|