C27H26F2IN3O5 — CID 22243934
5-[4-(2,4-dimethoxyphenyl)piperazine-1-carbonyl]-3,4-difluoro-2-(4-iodo-2-methylanilino)benzoic acid (PubChem CID 22243934) has the molecular formula C27H26F2IN3O5 and a molecular weight of 637.42 g/mol. Its IUPAC name is 5-[4-(2,4-dimethoxyphenyl)piperazine-1-carbonyl]-3,4-difluoro-2-(4-iodo-2-methylanilino)benzoic acid.
| Compound Name | 5-[4-(2,4-dimethoxyphenyl)piperazine-1-carbonyl]-3,4-difluoro-2-(4-iodo-2-methylanilino)benzoic acid |
|---|---|
| PubChem CID | 22243934 |
| Molecular Formula | C27H26F2IN3O5 |
| Molecular Weight | 637.42 g/mol |
| Exact Mass | 637.09 |
| IUPAC Name | 5-[4-(2,4-dimethoxyphenyl)piperazine-1-carbonyl]-3,4-difluoro-2-(4-iodo-2-methylanilino)benzoic acid |
| SMILES | COc1ccc(N2CCN(C(=O)c3cc(C(=O)O)c(Nc4ccc(I)cc4C)c(F)c3F)CC2)c(OC)c1 |
| InChI | InChI=1S/C27H26F2IN3O5/c1-15-12-16(30)4-6-20(15)31-25-19(27(35)36)14-18(23(28)24(25)29)26(34)33-10-8-32(9-11-33)21-7-5-17(37-2)13-22(21)38-3/h4-7,12-14,31H,8-11H2,1-3H3,(H,35,36) |
| InChIKey | QTHKZPSDNYPCSS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|