C18H17F2IN2O4 — CID 22243958
3,4-difluoro-5-(1-hydroxypropan-2-ylcarbamoyl)-2-(4-iodo-2-methylanilino)benzoic acid (PubChem CID 22243958) has the molecular formula C18H17F2IN2O4 and a molecular weight of 490.24 g/mol. Its IUPAC name is 3,4-difluoro-5-(1-hydroxypropan-2-ylcarbamoyl)-2-(4-iodo-2-methylanilino)benzoic acid.
| Compound Name | 3,4-difluoro-5-(1-hydroxypropan-2-ylcarbamoyl)-2-(4-iodo-2-methylanilino)benzoic acid |
|---|---|
| PubChem CID | 22243958 |
| Molecular Formula | C18H17F2IN2O4 |
| Molecular Weight | 490.24 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | 3,4-difluoro-5-(1-hydroxypropan-2-ylcarbamoyl)-2-(4-iodo-2-methylanilino)benzoic acid |
| SMILES | Cc1cc(I)ccc1Nc1c(C(=O)O)cc(C(=O)NC(C)CO)c(F)c1F |
| InChI | InChI=1S/C18H17F2IN2O4/c1-8-5-10(21)3-4-13(8)23-16-12(18(26)27)6-11(14(19)15(16)20)17(25)22-9(2)7-24/h3-6,9,23-24H,7H2,1-2H3,(H,22,25)(H,26,27) |
| InChIKey | SUMDMGVJFXGUDB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|