C24H28F2IN3O3 — CID 22243942
5-[3-(cyclohexylamino)propylcarbamoyl]-3,4-difluoro-2-(4-iodo-2-methylanilino)benzoic acid (PubChem CID 22243942) has the molecular formula C24H28F2IN3O3 and a molecular weight of 571.41 g/mol. Its IUPAC name is 5-[3-(cyclohexylamino)propylcarbamoyl]-3,4-difluoro-2-(4-iodo-2-methylanilino)benzoic acid.
| Compound Name | 5-[3-(cyclohexylamino)propylcarbamoyl]-3,4-difluoro-2-(4-iodo-2-methylanilino)benzoic acid |
|---|---|
| PubChem CID | 22243942 |
| Molecular Formula | C24H28F2IN3O3 |
| Molecular Weight | 571.41 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | 5-[3-(cyclohexylamino)propylcarbamoyl]-3,4-difluoro-2-(4-iodo-2-methylanilino)benzoic acid |
| SMILES | Cc1cc(I)ccc1Nc1c(C(=O)O)cc(C(=O)NCCCNC2CCCCC2)c(F)c1F |
| InChI | InChI=1S/C24H28F2IN3O3/c1-14-12-15(27)8-9-19(14)30-22-18(24(32)33)13-17(20(25)21(22)26)23(31)29-11-5-10-28-16-6-3-2-4-7-16/h8-9,12-13,16,28,30H,2-7,10-11H2,1H3,(H,29,31)(H,32,33) |
| InChIKey | QJZBHSYUMZIBJW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.41 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|