C22H23F2IN2O4 — CID 22244059
3,4-difluoro-5-[2-(2-hydroxyethyl)piperidine-1-carbonyl]-2-(4-iodo-2-methylanilino)benzoic acid (PubChem CID 22244059) has the molecular formula C22H23F2IN2O4 and a molecular weight of 544.34 g/mol. Its IUPAC name is 3,4-difluoro-5-[2-(2-hydroxyethyl)piperidine-1-carbonyl]-2-(4-iodo-2-methylanilino)benzoic acid.
| Compound Name | 3,4-difluoro-5-[2-(2-hydroxyethyl)piperidine-1-carbonyl]-2-(4-iodo-2-methylanilino)benzoic acid |
|---|---|
| PubChem CID | 22244059 |
| Molecular Formula | C22H23F2IN2O4 |
| Molecular Weight | 544.34 g/mol |
| Exact Mass | 544.07 |
| IUPAC Name | 3,4-difluoro-5-[2-(2-hydroxyethyl)piperidine-1-carbonyl]-2-(4-iodo-2-methylanilino)benzoic acid |
| SMILES | Cc1cc(I)ccc1Nc1c(C(=O)O)cc(C(=O)N2CCCCC2CCO)c(F)c1F |
| InChI | InChI=1S/C22H23F2IN2O4/c1-12-10-13(25)5-6-17(12)26-20-16(22(30)31)11-15(18(23)19(20)24)21(29)27-8-3-2-4-14(27)7-9-28/h5-6,10-11,14,26,28H,2-4,7-9H2,1H3,(H,30,31) |
| InChIKey | BBYWQGMWZSGAOZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.34 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|