C17H14F3IN2O2 — CID 25027256
[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-[2-(hydroxymethyl)azetidin-1-yl]methanone (PubChem CID 25027256) has the molecular formula C17H14F3IN2O2 and a molecular weight of 462.21 g/mol. Its IUPAC name is [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-[2-(hydroxymethyl)azetidin-1-yl]methanone.
| Compound Name | [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-[2-(hydroxymethyl)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 25027256 |
| Molecular Formula | C17H14F3IN2O2 |
| Molecular Weight | 462.21 g/mol |
| Exact Mass | 462.01 |
| IUPAC Name | [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-[2-(hydroxymethyl)azetidin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)c(F)c1Nc1ccc(I)cc1F)N1CCC1CO |
| InChI | InChI=1S/C17H14F3IN2O2/c18-12-3-2-11(17(25)23-6-5-10(23)8-24)16(15(12)20)22-14-4-1-9(21)7-13(14)19/h1-4,7,10,22,24H,5-6,8H2 |
| InChIKey | WCXUOAHSMZLHHJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.21 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|