C19H20F3IN4O — CID 91538558
[3-(1,3-diaminopropyl)azetidin-1-yl]-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanone (PubChem CID 91538558) has the molecular formula C19H20F3IN4O and a molecular weight of 504.29 g/mol. Its IUPAC name is [3-(1,3-diaminopropyl)azetidin-1-yl]-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanone.
| Compound Name | [3-(1,3-diaminopropyl)azetidin-1-yl]-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanone |
|---|---|
| PubChem CID | 91538558 |
| Molecular Formula | C19H20F3IN4O |
| Molecular Weight | 504.29 g/mol |
| Exact Mass | 504.06 |
| IUPAC Name | [3-(1,3-diaminopropyl)azetidin-1-yl]-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanone |
| SMILES | NCCC(N)C1CN(C(=O)c2ccc(F)c(F)c2Nc2ccc(I)cc2F)C1 |
| InChI | InChI=1S/C19H20F3IN4O/c20-13-3-2-12(19(28)27-8-10(9-27)15(25)5-6-24)18(17(13)22)26-16-4-1-11(23)7-14(16)21/h1-4,7,10,15,26H,5-6,8-9,24-25H2 |
| InChIKey | HXJBQKYIIDBLRJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|