C18H14BrF3IN3O2 — CID 67051593
2-bromo-N-[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]azetidin-3-yl]acetamide (PubChem CID 67051593) has the molecular formula C18H14BrF3IN3O2 and a molecular weight of 568.13 g/mol. Its IUPAC name is 2-bromo-N-[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]azetidin-3-yl]acetamide.
| Compound Name | 2-bromo-N-[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]azetidin-3-yl]acetamide |
|---|---|
| PubChem CID | 67051593 |
| Molecular Formula | C18H14BrF3IN3O2 |
| Molecular Weight | 568.13 g/mol |
| Exact Mass | 566.93 |
| IUPAC Name | 2-bromo-N-[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]azetidin-3-yl]acetamide |
| SMILES | O=C(CBr)NC1CN(C(=O)c2ccc(F)c(F)c2Nc2ccc(I)cc2F)C1 |
| InChI | InChI=1S/C18H14BrF3IN3O2/c19-6-15(27)24-10-7-26(8-10)18(28)11-2-3-12(20)16(22)17(11)25-14-4-1-9(23)5-13(14)21/h1-5,10,25H,6-8H2,(H,24,27) |
| InChIKey | JXHHDWYUANJLOH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.13 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|