C23H18ClF3IN3O — CID 138608495
[3-[(3-chloroanilino)methyl]azetidin-1-yl]-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanone (PubChem CID 138608495) has the molecular formula C23H18ClF3IN3O and a molecular weight of 571.77 g/mol. Its IUPAC name is [3-[(3-chloroanilino)methyl]azetidin-1-yl]-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanone.
| Compound Name | [3-[(3-chloroanilino)methyl]azetidin-1-yl]-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanone |
|---|---|
| PubChem CID | 138608495 |
| Molecular Formula | C23H18ClF3IN3O |
| Molecular Weight | 571.77 g/mol |
| Exact Mass | 571.01 |
| IUPAC Name | [3-[(3-chloroanilino)methyl]azetidin-1-yl]-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanone |
| SMILES | O=C(c1ccc(F)c(F)c1Nc1ccc(I)cc1F)N1CC(CNc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C23H18ClF3IN3O/c24-14-2-1-3-16(8-14)29-10-13-11-31(12-13)23(32)17-5-6-18(25)21(27)22(17)30-20-7-4-15(28)9-19(20)26/h1-9,13,29-30H,10-12H2 |
| InChIKey | MQOGRLJDIZHWLT-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.77 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|