C21H21F3IN3O2 — CID 151479405
[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-[3-(morpholin-4-ylmethyl)azetidin-1-yl]methanone (PubChem CID 151479405) has the molecular formula C21H21F3IN3O2 and a molecular weight of 531.32 g/mol. Its IUPAC name is [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-[3-(morpholin-4-ylmethyl)azetidin-1-yl]methanone.
| Compound Name | [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-[3-(morpholin-4-ylmethyl)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 151479405 |
| Molecular Formula | C21H21F3IN3O2 |
| Molecular Weight | 531.32 g/mol |
| Exact Mass | 531.06 |
| IUPAC Name | [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-[3-(morpholin-4-ylmethyl)azetidin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)c(F)c1Nc1ccc(I)cc1F)N1CC(CN2CCOCC2)C1 |
| InChI | InChI=1S/C21H21F3IN3O2/c22-16-3-2-15(20(19(16)24)26-18-4-1-14(25)9-17(18)23)21(29)28-11-13(12-28)10-27-5-7-30-8-6-27/h1-4,9,13,26H,5-8,10-12H2 |
| InChIKey | PMDLYDCIBJCBJN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|