C22H24F3IN4O2 — CID 118072595
2-[[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]azetidin-3-yl]amino]-N,N-diethylacetamide (PubChem CID 118072595) has the molecular formula C22H24F3IN4O2 and a molecular weight of 560.36 g/mol. Its IUPAC name is 2-[[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]azetidin-3-yl]amino]-N,N-diethylacetamide.
| Compound Name | 2-[[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]azetidin-3-yl]amino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 118072595 |
| Molecular Formula | C22H24F3IN4O2 |
| Molecular Weight | 560.36 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | 2-[[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]azetidin-3-yl]amino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CNC1CN(C(=O)c2ccc(F)c(F)c2Nc2ccc(I)cc2F)C1 |
| InChI | InChI=1S/C22H24F3IN4O2/c1-3-29(4-2)19(31)10-27-14-11-30(12-14)22(32)15-6-7-16(23)20(25)21(15)28-18-8-5-13(26)9-17(18)24/h5-9,14,27-28H,3-4,10-12H2,1-2H3 |
| InChIKey | LIBYFFLZRAEPFW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|