C20H21F3IN3O2 — CID 59468998
[3-(1-aminobutyl)-3-hydroxyazetidin-1-yl]-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanone (PubChem CID 59468998) has the molecular formula C20H21F3IN3O2 and a molecular weight of 519.31 g/mol. Its IUPAC name is [3-(1-aminobutyl)-3-hydroxyazetidin-1-yl]-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanone.
| Compound Name | [3-(1-aminobutyl)-3-hydroxyazetidin-1-yl]-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanone |
|---|---|
| PubChem CID | 59468998 |
| Molecular Formula | C20H21F3IN3O2 |
| Molecular Weight | 519.31 g/mol |
| Exact Mass | 519.06 |
| IUPAC Name | [3-(1-aminobutyl)-3-hydroxyazetidin-1-yl]-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanone |
| SMILES | CCCC(N)C1(O)CN(C(=O)c2ccc(F)c(F)c2Nc2ccc(I)cc2F)C1 |
| InChI | InChI=1S/C20H21F3IN3O2/c1-2-3-16(25)20(29)9-27(10-20)19(28)12-5-6-13(21)17(23)18(12)26-15-7-4-11(24)8-14(15)22/h4-8,16,26,29H,2-3,9-10,25H2,1H3 |
| InChIKey | JXFNFKZLJVMIJV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|