C21H20F6IN3O2 — CID 87250296
[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-[3-hydroxy-3-[2-(3,3,3-trifluoropropylamino)ethyl]azetidin-1-yl]methanone (PubChem CID 87250296) has the molecular formula C21H20F6IN3O2 and a molecular weight of 587.30 g/mol. Its IUPAC name is [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-[3-hydroxy-3-[2-(3,3,3-trifluoropropylamino)ethyl]azetidin-1-yl]methanone.
| Compound Name | [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-[3-hydroxy-3-[2-(3,3,3-trifluoropropylamino)ethyl]azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 87250296 |
| Molecular Formula | C21H20F6IN3O2 |
| Molecular Weight | 587.30 g/mol |
| Exact Mass | 587.05 |
| IUPAC Name | [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-[3-hydroxy-3-[2-(3,3,3-trifluoropropylamino)ethyl]azetidin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)c(F)c1Nc1ccc(I)cc1F)N1CC(O)(CCNCCC(F)(F)F)C1 |
| InChI | InChI=1S/C21H20F6IN3O2/c22-14-3-2-13(18(17(14)24)30-16-4-1-12(28)9-15(16)23)19(32)31-10-20(33,11-31)5-7-29-8-6-21(25,26)27/h1-4,9,29-30,33H,5-8,10-11H2 |
| InChIKey | NXYQLUVUWPNWJS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.30 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|