C20H18F3IN4O4S — CID 91318512
methyl N-[[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-hydroxyazetidin-3-yl]methyl]-2-nitroethanimidothioate (PubChem CID 91318512) has the molecular formula C20H18F3IN4O4S and a molecular weight of 594.35 g/mol. Its IUPAC name is methyl N-[[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-hydroxyazetidin-3-yl]methyl]-2-nitroethanimidothioate.
| Compound Name | methyl N-[[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-hydroxyazetidin-3-yl]methyl]-2-nitroethanimidothioate |
|---|---|
| PubChem CID | 91318512 |
| Molecular Formula | C20H18F3IN4O4S |
| Molecular Weight | 594.35 g/mol |
| Exact Mass | 594.00 |
| IUPAC Name | methyl N-[[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-hydroxyazetidin-3-yl]methyl]-2-nitroethanimidothioate |
| SMILES | CS/C(C[N+](=O)[O-])=N\CC1(O)CN(C(=O)c2ccc(F)c(F)c2Nc2ccc(I)cc2F)C1 |
| InChI | InChI=1S/C20H18F3IN4O4S/c1-33-16(7-28(31)32)25-8-20(30)9-27(10-20)19(29)12-3-4-13(21)17(23)18(12)26-15-5-2-11(24)6-14(15)22/h2-6,26,30H,7-10H2,1H3/b25-16- |
| InChIKey | FLBPUZYPJNTERU-XYGWBWBKSA-N |
| XLogP | 3.68 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|